C7H16NO4S+ — CID 5061106
(4-hydroxy-1,1-dioxothiolan-3-yl)-(3-hydroxypropyl)azanium (PubChem CID 5061106) has the molecular formula C7H16NO4S+ and a molecular weight of 210.27 g/mol. Its IUPAC name is (4-hydroxy-1,1-dioxothiolan-3-yl)-(3-hydroxypropyl)azanium.
| Compound Name | (4-hydroxy-1,1-dioxothiolan-3-yl)-(3-hydroxypropyl)azanium |
|---|---|
| PubChem CID | 5061106 |
| Molecular Formula | C7H16NO4S+ |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (4-hydroxy-1,1-dioxothiolan-3-yl)-(3-hydroxypropyl)azanium |
| SMILES | O=S1(=O)CC(O)C([NH2+]CCCO)C1 |
| InChI | InChI=1S/C7H15NO4S/c9-3-1-2-8-6-4-13(11,12)5-7(6)10/h6-10H,1-5H2/p+1 |
| InChIKey | UVQDNFWQAJOWAG-UHFFFAOYSA-O |
| XLogP | -2.91 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|