C17H11N5O3S — CID 5071488
N-(2-cyano-4-nitrophenyl)-2-phthalazin-1-ylsulfanylacetamide (PubChem CID 5071488) has the molecular formula C17H11N5O3S and a molecular weight of 365.37 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-2-phthalazin-1-ylsulfanylacetamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-2-phthalazin-1-ylsulfanylacetamide |
|---|---|
| PubChem CID | 5071488 |
| Molecular Formula | C17H11N5O3S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-2-phthalazin-1-ylsulfanylacetamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nncc2ccccc12 |
| InChI | InChI=1S/C17H11N5O3S/c18-8-12-7-13(22(24)25)5-6-15(12)20-16(23)10-26-17-14-4-2-1-3-11(14)9-19-21-17/h1-7,9H,10H2,(H,20,23) |
| InChIKey | SOOWDZGUFITOEI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|