C17H18N3O3S+ — CID 5081633
4-[4-(1H-imidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]sulfonylmorpholine (PubChem CID 5081633) has the molecular formula C17H18N3O3S+ and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[4-(1H-imidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-(1H-imidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 5081633 |
| Molecular Formula | C17H18N3O3S+ |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 4-[4-(1H-imidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc(-c2c[n+]3ccccc3[nH]2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C17H17N3O3S/c21-24(22,20-9-11-23-12-10-20)15-6-4-14(5-7-15)16-13-19-8-2-1-3-17(19)18-16/h1-8,13H,9-12H2/p+1 |
| InChIKey | FAHVTMMXGGKBGO-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 66.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|