C20H25NO3 — CID 50915775
(3S,4S,4aR,7S,12bR)-7-hydroxy-3-methyl-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-11-olate (PubChem CID 50915775) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (3S,4S,4aR,7S,12bR)-7-hydroxy-3-methyl-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-11-olate.
| Compound Name | (3S,4S,4aR,7S,12bR)-7-hydroxy-3-methyl-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-11-olate |
|---|---|
| PubChem CID | 50915775 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (3S,4S,4aR,7S,12bR)-7-hydroxy-3-methyl-3-prop-2-enyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-11-olate |
| SMILES | C=CC[N@+]1(C)CC[C@]23c4c5ccc([O-])c4C[C@H]1[C@@H]2CC[C@H](O)C3O5 |
| InChI | InChI=1S/C20H25NO3/c1-3-9-21(2)10-8-20-13-4-5-16(23)19(20)24-17-7-6-15(22)12(18(17)20)11-14(13)21/h3,6-7,13-14,16,19,23H,1,4-5,8-11H2,2H3/t13-,14-,16-,19?,20+,21+/m0/s1 |
| InChIKey | GIVYWCHIIROFKB-CQWSSTCASA-N |
| XLogP | 1.49 |
| TPSA | 52.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|