C19H21NO3S — CID 50919289
(1R,2R)-2-(furan-2-yl)-3-(4-methylphenyl)sulfonyl-1-prop-2-enyl-3-azabicyclo[3.1.0]hexane (PubChem CID 50919289) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is (1R,2R)-2-(furan-2-yl)-3-(4-methylphenyl)sulfonyl-1-prop-2-enyl-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,2R)-2-(furan-2-yl)-3-(4-methylphenyl)sulfonyl-1-prop-2-enyl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 50919289 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (1R,2R)-2-(furan-2-yl)-3-(4-methylphenyl)sulfonyl-1-prop-2-enyl-3-azabicyclo[3.1.0]hexane |
| SMILES | C=CC[C@@]12CC1CN(S(=O)(=O)c1ccc(C)cc1)[C@H]2c1ccco1 |
| InChI | InChI=1S/C19H21NO3S/c1-3-10-19-12-15(19)13-20(18(19)17-5-4-11-23-17)24(21,22)16-8-6-14(2)7-9-16/h3-9,11,15,18H,1,10,12-13H2,2H3/t15?,18-,19+/m0/s1 |
| InChIKey | TWKIQXHMZJFFEB-AOWWOYQVSA-N |
| XLogP | 3.92 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|