C11H15N3OS — CID 50928583
5,6-dimethyl-3-propyl-2-sulfanylidene-1H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 50928583) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 5,6-dimethyl-3-propyl-2-sulfanylidene-1H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-3-propyl-2-sulfanylidene-1H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 50928583 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 5,6-dimethyl-3-propyl-2-sulfanylidene-1H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCCn1c(=S)[nH]c2cc(C)n(C)c2c1=O |
| InChI | InChI=1S/C11H15N3OS/c1-4-5-14-10(15)9-8(12-11(14)16)6-7(2)13(9)3/h6H,4-5H2,1-3H3,(H,12,16) |
| InChIKey | YBMVHNKWLPKTOU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 42.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|