C24H27N3O4 — CID 50928871
2-[4-(2-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 50928871) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[4-(2-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(4-phenylbutan-2-yl)acetamide.
| Compound Name | 2-[4-(2-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(4-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 50928871 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-[4-(2-ethoxyphenyl)-2,3-dioxopyrazin-1-yl]-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | CCOc1ccccc1-n1ccn(CC(=O)NC(C)CCc2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C24H27N3O4/c1-3-31-21-12-8-7-11-20(21)27-16-15-26(23(29)24(27)30)17-22(28)25-18(2)13-14-19-9-5-4-6-10-19/h4-12,15-16,18H,3,13-14,17H2,1-2H3,(H,25,28) |
| InChIKey | YDZPBCPMKXXNED-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|