C8H16N2O2 — CID 50940631
(Z,2S)-1-nitrooct-5-en-2-amine (PubChem CID 50940631) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is (Z,2S)-1-nitrooct-5-en-2-amine.
| Compound Name | (Z,2S)-1-nitrooct-5-en-2-amine |
|---|---|
| PubChem CID | 50940631 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | (Z,2S)-1-nitrooct-5-en-2-amine |
| SMILES | CC/C=C\CC[C@H](N)C[N+](=O)[O-] |
| InChI | InChI=1S/C8H16N2O2/c1-2-3-4-5-6-8(9)7-10(11)12/h3-4,8H,2,5-7,9H2,1H3/b4-3-/t8-/m0/s1 |
| InChIKey | AVMLLUQDLLXJLP-VEMNSZJBSA-N |
| XLogP | 1.34 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|