C18H21N5O — CID 50972828
8-methyl-2-(6-phenylpyridazin-3-yl)-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one (PubChem CID 50972828) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 8-methyl-2-(6-phenylpyridazin-3-yl)-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one.
| Compound Name | 8-methyl-2-(6-phenylpyridazin-3-yl)-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 50972828 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 8-methyl-2-(6-phenylpyridazin-3-yl)-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
| SMILES | CN1CCN2CCN(c3ccc(-c4ccccc4)nn3)CC2C1=O |
| InChI | InChI=1S/C18H21N5O/c1-21-9-10-22-11-12-23(13-16(22)18(21)24)17-8-7-15(19-20-17)14-5-3-2-4-6-14/h2-8,16H,9-13H2,1H3 |
| InChIKey | VAUTUGSKPWEKQJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |