C21H23NO4 — CID 50993299
(2R,3R,4S,5R)-2-(3-benzyl-6-methylindol-1-yl)oxane-3,4,5-triol (PubChem CID 50993299) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(3-benzyl-6-methylindol-1-yl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-(3-benzyl-6-methylindol-1-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 50993299 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (2R,3R,4S,5R)-2-(3-benzyl-6-methylindol-1-yl)oxane-3,4,5-triol |
| SMILES | Cc1ccc2c(Cc3ccccc3)cn([C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)c2c1 |
| InChI | InChI=1S/C21H23NO4/c1-13-7-8-16-15(10-14-5-3-2-4-6-14)11-22(17(16)9-13)21-20(25)19(24)18(23)12-26-21/h2-9,11,18-21,23-25H,10,12H2,1H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | SPPPLDDFPUBVQT-PLACYPQZSA-N |
| XLogP | 2.15 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |