C18H33N3O4S3 — CID 50997691
N,N-diethylethanamine;4-[2-hydroxy-3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propoxy]butyl prop-2-enoate (PubChem CID 50997691) has the molecular formula C18H33N3O4S3 and a molecular weight of 451.68 g/mol. Its IUPAC name is N,N-diethylethanamine;4-[2-hydroxy-3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propoxy]butyl prop-2-enoate.
| Compound Name | N,N-diethylethanamine;4-[2-hydroxy-3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 50997691 |
| Molecular Formula | C18H33N3O4S3 |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | N,N-diethylethanamine;4-[2-hydroxy-3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]propoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOCC(O)CSc1n[nH]c(=S)s1.CCN(CC)CC |
| InChI | InChI=1S/C12H18N2O4S3.C6H15N/c1-2-10(16)18-6-4-3-5-17-7-9(15)8-20-12-14-13-11(19)21-12;1-4-7(5-2)6-3/h2,9,15H,1,3-8H2,(H,13,19);4-6H2,1-3H3 |
| InChIKey | CTLOMPQZIKZKJN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|