C14H22N3O5P — CID 51003442
8-(2,4-dioxo-6H-pyrrolo[3,4-d]pyrimidin-1-yl)octylphosphonic acid (PubChem CID 51003442) has the molecular formula C14H22N3O5P and a molecular weight of 343.32 g/mol. Its IUPAC name is 8-(2,4-dioxo-6H-pyrrolo[3,4-d]pyrimidin-1-yl)octylphosphonic acid.
| Compound Name | 8-(2,4-dioxo-6H-pyrrolo[3,4-d]pyrimidin-1-yl)octylphosphonic acid |
|---|---|
| PubChem CID | 51003442 |
| Molecular Formula | C14H22N3O5P |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 8-(2,4-dioxo-6H-pyrrolo[3,4-d]pyrimidin-1-yl)octylphosphonic acid |
| SMILES | O=c1[nH]c(=O)n(CCCCCCCCP(=O)(O)O)c2c[nH]cc12 |
| InChI | InChI=1S/C14H22N3O5P/c18-13-11-9-15-10-12(11)17(14(19)16-13)7-5-3-1-2-4-6-8-23(20,21)22/h9-10,15H,1-8H2,(H,16,18,19)(H2,20,21,22) |
| InChIKey | JLLCVMXCBQCMGV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|