C15H17NO4S2 — CID 51133565
(1,1-dioxothiolan-3-yl) 4-(1,3-benzothiazol-2-yl)butanoate (PubChem CID 51133565) has the molecular formula C15H17NO4S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) 4-(1,3-benzothiazol-2-yl)butanoate.
| Compound Name | (1,1-dioxothiolan-3-yl) 4-(1,3-benzothiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 51133565 |
| Molecular Formula | C15H17NO4S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (1,1-dioxothiolan-3-yl) 4-(1,3-benzothiazol-2-yl)butanoate |
| SMILES | O=C(CCCc1nc2ccccc2s1)OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H17NO4S2/c17-15(20-11-8-9-22(18,19)10-11)7-3-6-14-16-12-4-1-2-5-13(12)21-14/h1-2,4-5,11H,3,6-10H2 |
| InChIKey | QPHZXSVURKMHOZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |