C21H20F2N4O2S — CID 51351919
1-[4-[(5R,6R)-3-amino-5-(2,5-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-6-yl]phenyl]cyclopropane-1-carbonitrile (PubChem CID 51351919) has the molecular formula C21H20F2N4O2S and a molecular weight of 430.48 g/mol. Its IUPAC name is 1-[4-[(5R,6R)-3-amino-5-(2,5-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-6-yl]phenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-[(5R,6R)-3-amino-5-(2,5-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-6-yl]phenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 51351919 |
| Molecular Formula | C21H20F2N4O2S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-[4-[(5R,6R)-3-amino-5-(2,5-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-6-yl]phenyl]cyclopropane-1-carbonitrile |
| SMILES | CN1C(N)=N[C@](C)(c2cc(F)ccc2F)[C@@H](c2ccc(C3(C#N)CC3)cc2)S1(=O)=O |
| InChI | InChI=1S/C21H20F2N4O2S/c1-20(16-11-15(22)7-8-17(16)23)18(30(28,29)27(2)19(25)26-20)13-3-5-14(6-4-13)21(12-24)9-10-21/h3-8,11,18H,9-10H2,1-2H3,(H2,25,26)/t18-,20-/m1/s1 |
| InChIKey | KKCDGTQAMOLEPC-UYAOXDASSA-N |
| XLogP | 3.07 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |