C22H25F2N3O3S — CID 51351916
1-[4-[(5R,6R)-3-amino-5-(2,5-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-6-yl]phenyl]-2,2-dimethylpropan-1-one (PubChem CID 51351916) has the molecular formula C22H25F2N3O3S and a molecular weight of 449.52 g/mol. Its IUPAC name is 1-[4-[(5R,6R)-3-amino-5-(2,5-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-6-yl]phenyl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-[(5R,6R)-3-amino-5-(2,5-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-6-yl]phenyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 51351916 |
| Molecular Formula | C22H25F2N3O3S |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 1-[4-[(5R,6R)-3-amino-5-(2,5-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-6-yl]phenyl]-2,2-dimethylpropan-1-one |
| SMILES | CN1C(N)=N[C@](C)(c2cc(F)ccc2F)[C@@H](c2ccc(C(=O)C(C)(C)C)cc2)S1(=O)=O |
| InChI | InChI=1S/C22H25F2N3O3S/c1-21(2,3)18(28)13-6-8-14(9-7-13)19-22(4,16-12-15(23)10-11-17(16)24)26-20(25)27(5)31(19,29)30/h6-12,19H,1-5H3,(H2,25,26)/t19-,22-/m1/s1 |
| InChIKey | SXUIIPIEEMFTHP-DENIHFKCSA-N |
| XLogP | 3.74 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |