C25H31F2N3O4S — CID 77455158
tert-butyl N-[5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-(4-propan-2-ylphenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate (PubChem CID 77455158) has the molecular formula C25H31F2N3O4S and a molecular weight of 507.60 g/mol. Its IUPAC name is tert-butyl N-[5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-(4-propan-2-ylphenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-(4-propan-2-ylphenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 77455158 |
| Molecular Formula | C25H31F2N3O4S |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | tert-butyl N-[5-(2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-(4-propan-2-ylphenyl)-6H-1,2,4-thiadiazin-3-yl]carbamate |
| SMILES | CC(C)c1ccc(C2C(C)(c3ccc(F)cc3F)N=C(NC(=O)OC(C)(C)C)N(C)S2(=O)=O)cc1 |
| InChI | InChI=1S/C25H31F2N3O4S/c1-15(2)16-8-10-17(11-9-16)21-25(6,19-13-12-18(26)14-20(19)27)29-22(30(7)35(21,32)33)28-23(31)34-24(3,4)5/h8-15,21H,1-7H3,(H,28,29,31) |
| InChIKey | XYNZOOWLJRDFTF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |