C19H20F2N4O2S — CID 66581203
(5R,6S)-5-(2,4-difluorophenyl)-2-methyl-1,1-dioxo-6-(4-prop-1-en-2-ylphenyl)-6H-1,2,4-thiadiazine-3,5-diamine (PubChem CID 66581203) has the molecular formula C19H20F2N4O2S and a molecular weight of 406.46 g/mol. Its IUPAC name is (5R,6S)-5-(2,4-difluorophenyl)-2-methyl-1,1-dioxo-6-(4-prop-1-en-2-ylphenyl)-6H-1,2,4-thiadiazine-3,5-diamine.
| Compound Name | (5R,6S)-5-(2,4-difluorophenyl)-2-methyl-1,1-dioxo-6-(4-prop-1-en-2-ylphenyl)-6H-1,2,4-thiadiazine-3,5-diamine |
|---|---|
| PubChem CID | 66581203 |
| Molecular Formula | C19H20F2N4O2S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (5R,6S)-5-(2,4-difluorophenyl)-2-methyl-1,1-dioxo-6-(4-prop-1-en-2-ylphenyl)-6H-1,2,4-thiadiazine-3,5-diamine |
| SMILES | C=C(C)c1ccc([C@H]2[C@@](N)(c3ccc(F)cc3F)N=C(N)N(C)S2(=O)=O)cc1 |
| InChI | InChI=1S/C19H20F2N4O2S/c1-11(2)12-4-6-13(7-5-12)17-19(23,15-9-8-14(20)10-16(15)21)24-18(22)25(3)28(17,26)27/h4-10,17H,1,23H2,2-3H3,(H2,22,24)/t17-,19+/m0/s1 |
| InChIKey | ITONVIYVIYLPOD-PKOBYXMFSA-N |
| XLogP | 2.44 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |