C17H16BrF2N3O2S — CID 51352080
(5R,6R)-5-(5-bromo-2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-phenyl-6H-1,2,4-thiadiazin-3-amine (PubChem CID 51352080) has the molecular formula C17H16BrF2N3O2S and a molecular weight of 444.30 g/mol. Its IUPAC name is (5R,6R)-5-(5-bromo-2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-phenyl-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R,6R)-5-(5-bromo-2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-phenyl-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 51352080 |
| Molecular Formula | C17H16BrF2N3O2S |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | (5R,6R)-5-(5-bromo-2,4-difluorophenyl)-2,5-dimethyl-1,1-dioxo-6-phenyl-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2cc(Br)c(F)cc2F)[C@@H](c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C17H16BrF2N3O2S/c1-17(11-8-12(18)14(20)9-13(11)19)15(10-6-4-3-5-7-10)26(24,25)23(2)16(21)22-17/h3-9,15H,1-2H3,(H2,21,22)/t15-,17-/m1/s1 |
| InChIKey | ZNTRBPILJRJCPT-NVXWUHKLSA-N |
| XLogP | 3.27 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|