C23H29F2N3O3S — CID 51352469
(5R,6R)-5-(2,4-difluorophenyl)-6-[4-(1-ethoxy-2-methylpropan-2-yl)phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 51352469) has the molecular formula C23H29F2N3O3S and a molecular weight of 465.57 g/mol. Its IUPAC name is (5R,6R)-5-(2,4-difluorophenyl)-6-[4-(1-ethoxy-2-methylpropan-2-yl)phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R,6R)-5-(2,4-difluorophenyl)-6-[4-(1-ethoxy-2-methylpropan-2-yl)phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 51352469 |
| Molecular Formula | C23H29F2N3O3S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (5R,6R)-5-(2,4-difluorophenyl)-6-[4-(1-ethoxy-2-methylpropan-2-yl)phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CCOCC(C)(C)c1ccc([C@@H]2[C@@](C)(c3ccc(F)cc3F)N=C(N)N(C)S2(=O)=O)cc1 |
| InChI | InChI=1S/C23H29F2N3O3S/c1-6-31-14-22(2,3)16-9-7-15(8-10-16)20-23(4,18-12-11-17(24)13-19(18)25)27-21(26)28(5)32(20,29)30/h7-13,20H,6,14H2,1-5H3,(H2,26,27)/t20-,23-/m1/s1 |
| InChIKey | QDMWOAZPOLZYBD-NFBKMPQASA-N |
| XLogP | 3.83 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |