C25H38F12N2O2P2 — CID 51353839
12,25-dimethyl-2,8-dioxa-16,21-diazoniatricyclo[21.4.0.09,14]heptacosa-1(23),9(14),10,12,24,26-hexaene dihexafluorophosphate (PubChem CID 51353839) has the molecular formula C25H38F12N2O2P2 and a molecular weight of 688.52 g/mol. Its IUPAC name is 12,25-dimethyl-2,8-dioxa-16,21-diazoniatricyclo[21.4.0.09,14]heptacosa-1(23),9(14),10,12,24,26-hexaene dihexafluorophosphate.
| Compound Name | 12,25-dimethyl-2,8-dioxa-16,21-diazoniatricyclo[21.4.0.09,14]heptacosa-1(23),9(14),10,12,24,26-hexaene dihexafluorophosphate |
|---|---|
| PubChem CID | 51353839 |
| Molecular Formula | C25H38F12N2O2P2 |
| Molecular Weight | 688.52 g/mol |
| Exact Mass | 688.22 |
| IUPAC Name | 12,25-dimethyl-2,8-dioxa-16,21-diazoniatricyclo[21.4.0.09,14]heptacosa-1(23),9(14),10,12,24,26-hexaene dihexafluorophosphate |
| SMILES | Cc1ccc2c(c1)C[NH2+]CCCC[NH2+]Cc1cc(C)ccc1OCCCCCO2.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C25H36N2O2.2F6P/c1-20-8-10-24-22(16-20)18-26-12-4-5-13-27-19-23-17-21(2)9-11-25(23)29-15-7-3-6-14-28-24;2*1-7(2,3,4,5)6/h8-11,16-17,26-27H,3-7,12-15,18-19H2,1-2H3;;/q;2*-1/p+2 |
| InChIKey | UWYKQXZFWZUZEU-UHFFFAOYSA-P |
| XLogP | 9.62 |
| TPSA | 51.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.52 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|