C25H19NOS — CID 51368466
2,3-dimethyl-6-(4-methylphenyl)benzo[a]phenothiazin-5-one (PubChem CID 51368466) has the molecular formula C25H19NOS and a molecular weight of 381.50 g/mol. Its IUPAC name is 2,3-dimethyl-6-(4-methylphenyl)benzo[a]phenothiazin-5-one.
| Compound Name | 2,3-dimethyl-6-(4-methylphenyl)benzo[a]phenothiazin-5-one |
|---|---|
| PubChem CID | 51368466 |
| Molecular Formula | C25H19NOS |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2,3-dimethyl-6-(4-methylphenyl)benzo[a]phenothiazin-5-one |
| SMILES | Cc1ccc(-c2c3sc4ccccc4nc-3c3cc(C)c(C)cc3c2=O)cc1 |
| InChI | InChI=1S/C25H19NOS/c1-14-8-10-17(11-9-14)22-24(27)19-13-16(3)15(2)12-18(19)23-25(22)28-21-7-5-4-6-20(21)26-23/h4-13H,1-3H3 |
| InChIKey | BITJBCPJQFTGMS-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|