C12H11ClN4O4S — CID 51373050
N-[(2S)-3-acetyl-2-(2-chloro-5-nitrophenyl)-2H-1,3,4-thiadiazol-5-yl]acetamide (PubChem CID 51373050) has the molecular formula C12H11ClN4O4S and a molecular weight of 342.76 g/mol. Its IUPAC name is N-[(2S)-3-acetyl-2-(2-chloro-5-nitrophenyl)-2H-1,3,4-thiadiazol-5-yl]acetamide.
| Compound Name | N-[(2S)-3-acetyl-2-(2-chloro-5-nitrophenyl)-2H-1,3,4-thiadiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 51373050 |
| Molecular Formula | C12H11ClN4O4S |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | N-[(2S)-3-acetyl-2-(2-chloro-5-nitrophenyl)-2H-1,3,4-thiadiazol-5-yl]acetamide |
| SMILES | CC(=O)NC1=NN(C(C)=O)[C@H](c2cc([N+](=O)[O-])ccc2Cl)S1 |
| InChI | InChI=1S/C12H11ClN4O4S/c1-6(18)14-12-15-16(7(2)19)11(22-12)9-5-8(17(20)21)3-4-10(9)13/h3-5,11H,1-2H3,(H,14,15,18)/t11-/m0/s1 |
| InChIKey | UNZGFULPQPVXES-NSHDSACASA-N |
| XLogP | 2.25 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|