C24H26N4O2 — CID 51415285
(4R,4aR)-2-amino-4-(2-butoxy-4-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile (PubChem CID 51415285) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is (4R,4aR)-2-amino-4-(2-butoxy-4-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile.
| Compound Name | (4R,4aR)-2-amino-4-(2-butoxy-4-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 51415285 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (4R,4aR)-2-amino-4-(2-butoxy-4-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,1,3-tricarbonitrile |
| SMILES | CCCCOc1cc(OC)ccc1[C@H]1C(C#N)=C(N)C(C#N)(C#N)C2=CCCC[C@@H]21 |
| InChI | InChI=1S/C24H26N4O2/c1-3-4-11-30-21-12-16(29-2)9-10-18(21)22-17-7-5-6-8-20(17)24(14-26,15-27)23(28)19(22)13-25/h8-10,12,17,22H,3-7,11,28H2,1-2H3/t17-,22-/m0/s1 |
| InChIKey | ICWVBNOEGSLGPM-JTSKRJEESA-N |
| XLogP | 4.47 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|