C10H8N2O2 — CID 51423570
3-phenyl-1H-pyridazine-4,6-dione (PubChem CID 51423570) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 3-phenyl-1H-pyridazine-4,6-dione.
| Compound Name | 3-phenyl-1H-pyridazine-4,6-dione |
|---|---|
| PubChem CID | 51423570 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 3-phenyl-1H-pyridazine-4,6-dione |
| SMILES | O=C1CC(=O)C(c2ccccc2)=NN1 |
| InChI | InChI=1S/C10H8N2O2/c13-8-6-9(14)11-12-10(8)7-4-2-1-3-5-7/h1-5H,6H2,(H,11,14) |
| InChIKey | RNXTXZKWZAFFMZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|