C11H20N4O — CID 5150986
N-(1,2,4-triazol-4-yl)nonanamide (PubChem CID 5150986) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is N-(1,2,4-triazol-4-yl)nonanamide.
| Compound Name | N-(1,2,4-triazol-4-yl)nonanamide |
|---|---|
| PubChem CID | 5150986 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | N-(1,2,4-triazol-4-yl)nonanamide |
| SMILES | CCCCCCCCC(=O)Nn1cnnc1 |
| InChI | InChI=1S/C11H20N4O/c1-2-3-4-5-6-7-8-11(16)14-15-9-12-13-10-15/h9-10H,2-8H2,1H3,(H,14,16) |
| InChIKey | PVIQUWPIEVVUBZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|