C17H29N5O2S2 — CID 51518167
1-butyl-3-[[5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-pyridinyl]amino]thiourea (PubChem CID 51518167) has the molecular formula C17H29N5O2S2 and a molecular weight of 399.59 g/mol. Its IUPAC name is 1-butyl-3-[[5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-pyridinyl]amino]thiourea.
| Compound Name | 1-butyl-3-[[5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-pyridinyl]amino]thiourea |
|---|---|
| PubChem CID | 51518167 |
| Molecular Formula | C17H29N5O2S2 |
| Molecular Weight | 399.59 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-butyl-3-[[5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-pyridinyl]amino]thiourea |
| SMILES | CCCCNC(=S)NNc1ccc(S(=O)(=O)N2C[C@H](C)C[C@H](C)C2)cn1 |
| InChI | InChI=1S/C17H29N5O2S2/c1-4-5-8-18-17(25)21-20-16-7-6-15(10-19-16)26(23,24)22-11-13(2)9-14(3)12-22/h6-7,10,13-14H,4-5,8-9,11-12H2,1-3H3,(H,19,20)(H2,18,21,25)/t13-,14+ |
| InChIKey | ZZTOUYVYBVIAMA-OKILXGFUSA-N |
| XLogP | 2.34 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|