C16H25N5O2S2 — CID 40700636
1-[[5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-pyridinyl]amino]-3-prop-2-enylthiourea (PubChem CID 40700636) has the molecular formula C16H25N5O2S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-[[5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-pyridinyl]amino]-3-prop-2-enylthiourea.
| Compound Name | 1-[[5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-pyridinyl]amino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 40700636 |
| Molecular Formula | C16H25N5O2S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 1-[[5-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-pyridinyl]amino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNc1ccc(S(=O)(=O)N2C[C@@H](C)C[C@H](C)C2)cn1 |
| InChI | InChI=1S/C16H25N5O2S2/c1-4-7-17-16(24)20-19-15-6-5-14(9-18-15)25(22,23)21-10-12(2)8-13(3)11-21/h4-6,9,12-13H,1,7-8,10-11H2,2-3H3,(H,18,19)(H2,17,20,24)/t12-,13-/m0/s1 |
| InChIKey | IPPNWMWGWKQYAE-STQMWFEESA-N |
| XLogP | 1.73 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|