C21H22N2O4 — CID 515992
5-[3-[2,6-dimethyl-4-(4-nitrophenyl)phenoxy]propyl]-3-methyl-1,2-oxazole (PubChem CID 515992) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 5-[3-[2,6-dimethyl-4-(4-nitrophenyl)phenoxy]propyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[3-[2,6-dimethyl-4-(4-nitrophenyl)phenoxy]propyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 515992 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 5-[3-[2,6-dimethyl-4-(4-nitrophenyl)phenoxy]propyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(CCCOc2c(C)cc(-c3ccc([N+](=O)[O-])cc3)cc2C)on1 |
| InChI | InChI=1S/C21H22N2O4/c1-14-11-18(17-6-8-19(9-7-17)23(24)25)12-15(2)21(14)26-10-4-5-20-13-16(3)22-27-20/h6-9,11-13H,4-5,10H2,1-3H3 |
| InChIKey | SZLPTFXRPFCVTK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|