C22H22N2O2 — CID 515995
4-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]benzonitrile (PubChem CID 515995) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]benzonitrile.
| Compound Name | 4-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 515995 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]benzonitrile |
| SMILES | Cc1cc(CCCOc2c(C)cc(-c3ccc(C#N)cc3)cc2C)on1 |
| InChI | InChI=1S/C22H22N2O2/c1-15-11-20(19-8-6-18(14-23)7-9-19)12-16(2)22(15)25-10-4-5-21-13-17(3)24-26-21/h6-9,11-13H,4-5,10H2,1-3H3 |
| InChIKey | ROZXBKALYZKUSC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|