C19H25N3O7S — CID 51695759
3-[(3,4-dimethyl-N-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]anilino)diazenyl]benzenesulfonic acid (PubChem CID 51695759) has the molecular formula C19H25N3O7S and a molecular weight of 439.49 g/mol. Its IUPAC name is 3-[(3,4-dimethyl-N-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]anilino)diazenyl]benzenesulfonic acid.
| Compound Name | 3-[(3,4-dimethyl-N-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]anilino)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 51695759 |
| Molecular Formula | C19H25N3O7S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 3-[(3,4-dimethyl-N-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]anilino)diazenyl]benzenesulfonic acid |
| SMILES | Cc1ccc(N(C[C@H](O)[C@@H](O)[C@H](O)CO)/N=N/c2cccc(S(=O)(=O)O)c2)cc1C |
| InChI | InChI=1S/C19H25N3O7S/c1-12-6-7-15(8-13(12)2)22(10-17(24)19(26)18(25)11-23)21-20-14-4-3-5-16(9-14)30(27,28)29/h3-9,17-19,23-26H,10-11H2,1-2H3,(H,27,28,29)/b21-20+/t17-,18+,19+/m0/s1 |
| InChIKey | OOMLWVJCNNEQRU-CMFXCSMKSA-N |
| XLogP | 1.13 |
| TPSA | 163.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|