C19H24N4O7 — CID 7111845
(2S,3S,4S)-5-(3,4-dimethyl-N-[(4-nitrophenyl)diazenyl]anilino)pentane-1,1,2,3,4-pentol (PubChem CID 7111845) has the molecular formula C19H24N4O7 and a molecular weight of 420.42 g/mol. Its IUPAC name is (2S,3S,4S)-5-(3,4-dimethyl-N-[(4-nitrophenyl)diazenyl]anilino)pentane-1,1,2,3,4-pentol.
| Compound Name | (2S,3S,4S)-5-(3,4-dimethyl-N-[(4-nitrophenyl)diazenyl]anilino)pentane-1,1,2,3,4-pentol |
|---|---|
| PubChem CID | 7111845 |
| Molecular Formula | C19H24N4O7 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (2S,3S,4S)-5-(3,4-dimethyl-N-[(4-nitrophenyl)diazenyl]anilino)pentane-1,1,2,3,4-pentol |
| SMILES | Cc1ccc(N(C[C@H](O)[C@H](O)[C@H](O)C(O)O)/N=N/c2ccc([N+](=O)[O-])cc2)cc1C |
| InChI | InChI=1S/C19H24N4O7/c1-11-3-6-15(9-12(11)2)22(10-16(24)17(25)18(26)19(27)28)21-20-13-4-7-14(8-5-13)23(29)30/h3-9,16-19,24-28H,10H2,1-2H3/b21-20+/t16-,17-,18-/m0/s1 |
| InChIKey | OGHJAZSPZUUJID-FDUSRNQMSA-N |
| XLogP | 1.11 |
| TPSA | 172.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|