C20H22O5S — CID 51728783
[(1S,6R)-6-methylcyclohex-3-en-1-yl]methyl 5-(benzenesulfonylmethyl)furan-2-carboxylate (PubChem CID 51728783) has the molecular formula C20H22O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is [(1S,6R)-6-methylcyclohex-3-en-1-yl]methyl 5-(benzenesulfonylmethyl)furan-2-carboxylate.
| Compound Name | [(1S,6R)-6-methylcyclohex-3-en-1-yl]methyl 5-(benzenesulfonylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 51728783 |
| Molecular Formula | C20H22O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [(1S,6R)-6-methylcyclohex-3-en-1-yl]methyl 5-(benzenesulfonylmethyl)furan-2-carboxylate |
| SMILES | C[C@@H]1CC=CC[C@@H]1COC(=O)c1ccc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C20H22O5S/c1-15-7-5-6-8-16(15)13-24-20(21)19-12-11-17(25-19)14-26(22,23)18-9-3-2-4-10-18/h2-6,9-12,15-16H,7-8,13-14H2,1H3/t15-,16-/m1/s1 |
| InChIKey | LIOACNNRSKTPMZ-HZPDHXFCSA-N |
| XLogP | 4.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|