C15H18ClNO — CID 5179624
3-(3-chlorophenyl)-3-(2,5-dimethylpyrrol-1-yl)propan-1-ol (PubChem CID 5179624) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-3-(2,5-dimethylpyrrol-1-yl)propan-1-ol.
| Compound Name | 3-(3-chlorophenyl)-3-(2,5-dimethylpyrrol-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 5179624 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3-(3-chlorophenyl)-3-(2,5-dimethylpyrrol-1-yl)propan-1-ol |
| SMILES | Cc1ccc(C)n1C(CCO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H18ClNO/c1-11-6-7-12(2)17(11)15(8-9-18)13-4-3-5-14(16)10-13/h3-7,10,15,18H,8-9H2,1-2H3 |
| InChIKey | XSVVXIYJPGSYIQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |