C19H33N3O5 — CID 5182979
ethyl 6-[[4-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate (PubChem CID 5182979) has the molecular formula C19H33N3O5 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl 6-[[4-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate.
| Compound Name | ethyl 6-[[4-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 5182979 |
| Molecular Formula | C19H33N3O5 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | ethyl 6-[[4-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate |
| SMILES | CCOC(=O)CCCCCNC(=O)N1CCC(N2CC(CC)OC2=O)CC1 |
| InChI | InChI=1S/C19H33N3O5/c1-3-16-14-22(19(25)27-16)15-9-12-21(13-10-15)18(24)20-11-7-5-6-8-17(23)26-4-2/h15-16H,3-14H2,1-2H3,(H,20,24) |
| InChIKey | APUYIJBIIGPZGR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|