C22H22ClN3OS — CID 51886959
3-[[(1R,4S)-4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,3-oxazolidine-2-thione (PubChem CID 51886959) has the molecular formula C22H22ClN3OS and a molecular weight of 411.96 g/mol. Its IUPAC name is 3-[[(1R,4S)-4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,3-oxazolidine-2-thione.
| Compound Name | 3-[[(1R,4S)-4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 51886959 |
| Molecular Formula | C22H22ClN3OS |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 3-[[(1R,4S)-4-(2-chlorophenyl)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,3-oxazolidine-2-thione |
| SMILES | C[C@@H]1c2[nH]c3ccccc3c2[C@@H](c2ccccc2Cl)CN1CN1CCOC1=S |
| InChI | InChI=1S/C22H22ClN3OS/c1-14-21-20(16-7-3-5-9-19(16)24-21)17(15-6-2-4-8-18(15)23)12-26(14)13-25-10-11-27-22(25)28/h2-9,14,17,24H,10-13H2,1H3/t14-,17-/m1/s1 |
| InChIKey | CRCPGUJCIPLCNA-RHSMWYFYSA-N |
| XLogP | 4.90 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|