C14H16Cl2N2O2S — CID 5191764
2-(2,4-dichlorophenoxy)-N-(pyrrolidine-1-carbothioyl)propanamide (PubChem CID 5191764) has the molecular formula C14H16Cl2N2O2S and a molecular weight of 347.27 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(pyrrolidine-1-carbothioyl)propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(pyrrolidine-1-carbothioyl)propanamide |
|---|---|
| PubChem CID | 5191764 |
| Molecular Formula | C14H16Cl2N2O2S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(pyrrolidine-1-carbothioyl)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)N1CCCC1 |
| InChI | InChI=1S/C14H16Cl2N2O2S/c1-9(20-12-5-4-10(15)8-11(12)16)13(19)17-14(21)18-6-2-3-7-18/h4-5,8-9H,2-3,6-7H2,1H3,(H,17,19,21) |
| InChIKey | ZSPIQCSBABXIPF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|