C20H24Cl2N2O2S — CID 27059827
(2S)-N-(2-adamantylcarbamothioyl)-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 27059827) has the molecular formula C20H24Cl2N2O2S and a molecular weight of 427.40 g/mol. Its IUPAC name is (2S)-N-(2-adamantylcarbamothioyl)-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | (2S)-N-(2-adamantylcarbamothioyl)-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 27059827 |
| Molecular Formula | C20H24Cl2N2O2S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (2S)-N-(2-adamantylcarbamothioyl)-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H24Cl2N2O2S/c1-10(26-17-3-2-15(21)9-16(17)22)19(25)24-20(27)23-18-13-5-11-4-12(7-13)8-14(18)6-11/h2-3,9-14,18H,4-8H2,1H3,(H2,23,24,25,27)/t10-,11?,12?,13?,14?,18?/m0/s1 |
| InChIKey | IMWHGYBSZZVLLN-SYSDIAMWSA-N |
| XLogP | 4.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|