C17H18BrNO4S2 — CID 51929696
thiophen-2-ylmethyl (2R)-1-(4-bromophenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 51929696) has the molecular formula C17H18BrNO4S2 and a molecular weight of 444.37 g/mol. Its IUPAC name is thiophen-2-ylmethyl (2R)-1-(4-bromophenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | thiophen-2-ylmethyl (2R)-1-(4-bromophenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 51929696 |
| Molecular Formula | C17H18BrNO4S2 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | thiophen-2-ylmethyl (2R)-1-(4-bromophenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | O=C(OCc1cccs1)[C@H]1CCCCN1S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrNO4S2/c18-13-6-8-15(9-7-13)25(21,22)19-10-2-1-5-16(19)17(20)23-12-14-4-3-11-24-14/h3-4,6-9,11,16H,1-2,5,10,12H2/t16-/m1/s1 |
| InChIKey | INBSCROBWCUMDZ-MRXNPFEDSA-N |
| XLogP | 3.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |