C26H29N5O3 — CID 51933459
3,7-dibenzyl-1-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropyl]purine-2,6-dione (PubChem CID 51933459) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is 3,7-dibenzyl-1-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropyl]purine-2,6-dione.
| Compound Name | 3,7-dibenzyl-1-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropyl]purine-2,6-dione |
|---|---|
| PubChem CID | 51933459 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 3,7-dibenzyl-1-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropyl]purine-2,6-dione |
| SMILES | O=c1c2c(ncn2Cc2ccccc2)n(Cc2ccccc2)c(=O)n1C[C@@H](O)CN1CCCC1 |
| InChI | InChI=1S/C26H29N5O3/c32-22(17-28-13-7-8-14-28)18-31-25(33)23-24(27-19-29(23)15-20-9-3-1-4-10-20)30(26(31)34)16-21-11-5-2-6-12-21/h1-6,9-12,19,22,32H,7-8,13-18H2/t22-/m0/s1 |
| InChIKey | XZBYIALSFIPNEA-QFIPXVFZSA-N |
| XLogP | 1.91 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |