C25H22N6O2 — CID 51927585
(2S)-2-[(3,7-dibenzyl-2,6-dioxopurin-1-yl)methyl]pentanedinitrile (PubChem CID 51927585) has the molecular formula C25H22N6O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is (2S)-2-[(3,7-dibenzyl-2,6-dioxopurin-1-yl)methyl]pentanedinitrile.
| Compound Name | (2S)-2-[(3,7-dibenzyl-2,6-dioxopurin-1-yl)methyl]pentanedinitrile |
|---|---|
| PubChem CID | 51927585 |
| Molecular Formula | C25H22N6O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (2S)-2-[(3,7-dibenzyl-2,6-dioxopurin-1-yl)methyl]pentanedinitrile |
| SMILES | N#CCC[C@H](C#N)Cn1c(=O)c2c(ncn2Cc2ccccc2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C25H22N6O2/c26-13-7-12-21(14-27)17-31-24(32)22-23(28-18-29(22)15-19-8-3-1-4-9-19)30(25(31)33)16-20-10-5-2-6-11-20/h1-6,8-11,18,21H,7,12,15-17H2/t21-/m1/s1 |
| InChIKey | JJJQVYZYTBKQJM-OAQYLSRUSA-N |
| XLogP | 2.90 |
| TPSA | 109.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |