C25H22N4O4 — CID 51929548
3-benzyl-7-(furan-2-ylmethyl)-1-[(2R)-2-hydroxy-2-phenylethyl]purine-2,6-dione (PubChem CID 51929548) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 3-benzyl-7-(furan-2-ylmethyl)-1-[(2R)-2-hydroxy-2-phenylethyl]purine-2,6-dione.
| Compound Name | 3-benzyl-7-(furan-2-ylmethyl)-1-[(2R)-2-hydroxy-2-phenylethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 51929548 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-benzyl-7-(furan-2-ylmethyl)-1-[(2R)-2-hydroxy-2-phenylethyl]purine-2,6-dione |
| SMILES | O=c1c2c(ncn2Cc2ccco2)n(Cc2ccccc2)c(=O)n1C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C25H22N4O4/c30-21(19-10-5-2-6-11-19)16-29-24(31)22-23(26-17-27(22)15-20-12-7-13-33-20)28(25(29)32)14-18-8-3-1-4-9-18/h1-13,17,21,30H,14-16H2/t21-/m0/s1 |
| InChIKey | ZQAIGZSIAVRORW-NRFANRHFSA-N |
| XLogP | 2.78 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |