C23H18ClF3N2O — CID 51956906
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-N-[(S)-phenyl(pyridin-2-yl)methyl]prop-2-enamide (PubChem CID 51956906) has the molecular formula C23H18ClF3N2O and a molecular weight of 430.86 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-N-[(S)-phenyl(pyridin-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-N-[(S)-phenyl(pyridin-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 51956906 |
| Molecular Formula | C23H18ClF3N2O |
| Molecular Weight | 430.86 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-N-[(S)-phenyl(pyridin-2-yl)methyl]prop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1ccc(Cl)c(C(F)(F)F)c1)[C@@H](c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C23H18ClF3N2O/c1-29(22(17-7-3-2-4-8-17)20-9-5-6-14-28-20)21(30)13-11-16-10-12-19(24)18(15-16)23(25,26)27/h2-15,22H,1H3/b13-11+/t22-/m0/s1 |
| InChIKey | RACCLADVNPHGKG-SDNYCIMKSA-N |
| XLogP | 6.01 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.86 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|