C15H20N2O2S4 — CID 51961969
(3S,8aR)-8a-methyl-5-oxo-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-3,8-dihydro-2H-[1,3]thiazolo[2,3-c][1,4]thiazine-3-carboxamide (PubChem CID 51961969) has the molecular formula C15H20N2O2S4 and a molecular weight of 388.61 g/mol. Its IUPAC name is (3S,8aR)-8a-methyl-5-oxo-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-3,8-dihydro-2H-[1,3]thiazolo[2,3-c][1,4]thiazine-3-carboxamide.
| Compound Name | (3S,8aR)-8a-methyl-5-oxo-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-3,8-dihydro-2H-[1,3]thiazolo[2,3-c][1,4]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 51961969 |
| Molecular Formula | C15H20N2O2S4 |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | (3S,8aR)-8a-methyl-5-oxo-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-3,8-dihydro-2H-[1,3]thiazolo[2,3-c][1,4]thiazine-3-carboxamide |
| SMILES | C[C@@]12CSCC(=O)N1[C@@H](C(=O)NCCSCc1cccs1)CS2 |
| InChI | InChI=1S/C15H20N2O2S4/c1-15-10-21-9-13(18)17(15)12(8-23-15)14(19)16-4-6-20-7-11-3-2-5-22-11/h2-3,5,12H,4,6-10H2,1H3,(H,16,19)/t12-,15-/m1/s1 |
| InChIKey | YOXUWRNZAQRACV-IUODEOHRSA-N |
| XLogP | 2.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|