C21H28N2O5S2 — CID 51962002
(3R,8aS)-N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]-8a-methyl-5-oxo-3,8-dihydro-2H-[1,3]thiazolo[2,3-c][1,4]thiazine-3-carboxamide (PubChem CID 51962002) has the molecular formula C21H28N2O5S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is (3R,8aS)-N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]-8a-methyl-5-oxo-3,8-dihydro-2H-[1,3]thiazolo[2,3-c][1,4]thiazine-3-carboxamide.
| Compound Name | (3R,8aS)-N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]-8a-methyl-5-oxo-3,8-dihydro-2H-[1,3]thiazolo[2,3-c][1,4]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 51962002 |
| Molecular Formula | C21H28N2O5S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (3R,8aS)-N-[[3-methoxy-4-[[(2S)-oxolan-2-yl]methoxy]phenyl]methyl]-8a-methyl-5-oxo-3,8-dihydro-2H-[1,3]thiazolo[2,3-c][1,4]thiazine-3-carboxamide |
| SMILES | COc1cc(CNC(=O)[C@@H]2CS[C@@]3(C)CSCC(=O)N23)ccc1OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C21H28N2O5S2/c1-21-13-29-12-19(24)23(21)16(11-30-21)20(25)22-9-14-5-6-17(18(8-14)26-2)28-10-15-4-3-7-27-15/h5-6,8,15-16H,3-4,7,9-13H2,1-2H3,(H,22,25)/t15-,16-,21-/m0/s1 |
| InChIKey | BTNKFLGJVUWMQK-QYWGDWMGSA-N |
| XLogP | 2.28 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |