C18H17BrN2O5S — CID 5211895
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5211895) has the molecular formula C18H17BrN2O5S and a molecular weight of 453.31 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5211895 |
| Molecular Formula | C18H17BrN2O5S |
| Molecular Weight | 453.31 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC1CCc2c(C(=O)OCC(=O)Nc3ccc([N+](=O)[O-])cc3Br)csc2C1 |
| InChI | InChI=1S/C18H17BrN2O5S/c1-10-2-4-12-13(9-27-16(12)6-10)18(23)26-8-17(22)20-15-5-3-11(21(24)25)7-14(15)19/h3,5,7,9-10H,2,4,6,8H2,1H3,(H,20,22) |
| InChIKey | LPYFYZZUGSRMOV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|