C24H17Cl2N3O — CID 5215359
1-(3,4-dichlorophenyl)-3-[2-(5-phenylpenta-2,4-diynylamino)phenyl]urea (PubChem CID 5215359) has the molecular formula C24H17Cl2N3O and a molecular weight of 434.33 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-(5-phenylpenta-2,4-diynylamino)phenyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-(5-phenylpenta-2,4-diynylamino)phenyl]urea |
|---|---|
| PubChem CID | 5215359 |
| Molecular Formula | C24H17Cl2N3O |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-(5-phenylpenta-2,4-diynylamino)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1ccccc1NCC#CC#Cc1ccccc1 |
| InChI | InChI=1S/C24H17Cl2N3O/c25-20-15-14-19(17-21(20)26)28-24(30)29-23-13-7-6-12-22(23)27-16-8-2-5-11-18-9-3-1-4-10-18/h1,3-4,6-7,9-10,12-15,17,27H,16H2,(H2,28,29,30) |
| InChIKey | BSHJHVUFHMQGFT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|