C7H7BrCl2O2 — CID 5251128
2-bromo-7,7-dichloro-3-hydroxybicyclo[3.2.0]heptan-6-one (PubChem CID 5251128) has the molecular formula C7H7BrCl2O2 and a molecular weight of 273.94 g/mol. Its IUPAC name is 2-bromo-7,7-dichloro-3-hydroxybicyclo[3.2.0]heptan-6-one.
| Compound Name | 2-bromo-7,7-dichloro-3-hydroxybicyclo[3.2.0]heptan-6-one |
|---|---|
| PubChem CID | 5251128 |
| Molecular Formula | C7H7BrCl2O2 |
| Molecular Weight | 273.94 g/mol |
| Exact Mass | 271.90 |
| IUPAC Name | 2-bromo-7,7-dichloro-3-hydroxybicyclo[3.2.0]heptan-6-one |
| SMILES | O=C1C2CC(O)C(Br)C2C1(Cl)Cl |
| InChI | InChI=1S/C7H7BrCl2O2/c8-5-3(11)1-2-4(5)7(9,10)6(2)12/h2-5,11H,1H2 |
| InChIKey | HHNOSMIZUYFFOX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.94 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|