C17H15Cl2NO4 — CID 5255926
[3a-(3,4-dichlorophenyl)-2-methyl-1,3-dioxo-7,7a-dihydro-4H-isoindol-4-yl] acetate (PubChem CID 5255926) has the molecular formula C17H15Cl2NO4 and a molecular weight of 368.22 g/mol. Its IUPAC name is [3a-(3,4-dichlorophenyl)-2-methyl-1,3-dioxo-7,7a-dihydro-4H-isoindol-4-yl] acetate.
| Compound Name | [3a-(3,4-dichlorophenyl)-2-methyl-1,3-dioxo-7,7a-dihydro-4H-isoindol-4-yl] acetate |
|---|---|
| PubChem CID | 5255926 |
| Molecular Formula | C17H15Cl2NO4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | [3a-(3,4-dichlorophenyl)-2-methyl-1,3-dioxo-7,7a-dihydro-4H-isoindol-4-yl] acetate |
| SMILES | CC(=O)OC1C=CCC2C(=O)N(C)C(=O)C12c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2NO4/c1-9(21)24-14-5-3-4-11-15(22)20(2)16(23)17(11,14)10-6-7-12(18)13(19)8-10/h3,5-8,11,14H,4H2,1-2H3 |
| InChIKey | CPOOLGBYCYYEIP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|