C9H9FN2O5 — CID 5276643
(2R,4R,5R,6S)-11-fluoro-5-hydroxy-4-(hydroxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one (PubChem CID 5276643) has the molecular formula C9H9FN2O5 and a molecular weight of 244.18 g/mol. Its IUPAC name is (2R,4R,5R,6S)-11-fluoro-5-hydroxy-4-(hydroxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one.
| Compound Name | (2R,4R,5R,6S)-11-fluoro-5-hydroxy-4-(hydroxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
|---|---|
| PubChem CID | 5276643 |
| Molecular Formula | C9H9FN2O5 |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (2R,4R,5R,6S)-11-fluoro-5-hydroxy-4-(hydroxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
| SMILES | O=c1nc2n(cc1F)[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O2 |
| InChI | InChI=1S/C9H9FN2O5/c10-3-1-12-8-6(5(14)4(2-13)16-8)17-9(12)11-7(3)15/h1,4-6,8,13-14H,2H2/t4-,5-,6+,8-/m1/s1 |
| InChIKey | IKFXNFGQZPQQSR-MNCSTQPFSA-N |
| XLogP | -1.61 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |