C9H11FN3O7P — CID 90669028
[(2R,4R,5R,6R)-11-fluoro-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] dihydrogen phosphate (PubChem CID 90669028) has the molecular formula C9H11FN3O7P and a molecular weight of 323.17 g/mol. Its IUPAC name is [(2R,4R,5R,6R)-11-fluoro-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] dihydrogen phosphate.
| Compound Name | [(2R,4R,5R,6R)-11-fluoro-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90669028 |
| Molecular Formula | C9H11FN3O7P |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | [(2R,4R,5R,6R)-11-fluoro-4-(hydroxymethyl)-10-imino-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] dihydrogen phosphate |
| SMILES | [H]/N=c1\nc2n(cc1F)[C@@H]1O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H]1O2 |
| InChI | InChI=1S/C9H11FN3O7P/c10-3-1-13-8-6(19-9(13)12-7(3)11)5(4(2-14)18-8)20-21(15,16)17/h1,4-6,8,11,14H,2H2,(H2,15,16,17)/b11-7-/t4-,5-,6-,8-/m1/s1 |
| InChIKey | RQYFYOGATBJJKI-WOQIZAMCSA-N |
| XLogP | -1.37 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|